Introduction:Basic information about CAS 26562-81-2|adamantane-1,3-diaminium dichloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | adamantane-1,3-diaminium dichloride |
|---|
| CAS Number | 26562-81-2 | Molecular Weight | 239.185 |
|---|
| Density | / | Boiling Point | 248.6ºC at 760mmHg |
|---|
| Molecular Formula | C10H20Cl2N2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 122ºC |
|---|
Names
| Name | adamantane-1,3-diamine,dihydrochloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 248.6ºC at 760mmHg |
|---|
| Molecular Formula | C10H20Cl2N2 |
|---|
| Molecular Weight | 239.185 |
|---|
| Flash Point | 122ºC |
|---|
| Exact Mass | 238.100357 |
|---|
| PSA | 52.04000 |
|---|
| LogP | 3.99980 |
|---|
| Vapour Pressure | 0.0241mmHg at 25°C |
|---|
| InChIKey | JFXXSCYTYFTSNO-UHFFFAOYSA-N |
|---|
| SMILES | Cl.Cl.NC12CC3CC(C1)CC(N)(C3)C2 |
|---|
Safety Information
Customs
| HS Code | 2921300090 |
|---|
| Summary | 2921300090 other cyclanic, cyclenic or cyclotherpenic mono- or polyamines, and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| adamantane-1,3-diyldiamine,dihydrochloride |
| adamantane-1,3-diaminium dichloride |
| Adamantan-1,3-diyldiamin,Dihydrochlorid |
| Adamantane-1,3-diamine dihydrochloride |
| 1,3-Adamantanediamine dihydrochloride |
| 1,3-Diaminoadamantanedihydrochloride |
| Tricyclo[3.3.1.1]decane-1,3-diamine, hydrochloride (1:2) |