Introduction：Basic information about CAS 80763-86-6|Glunicate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Glunicate |
|---|
| CAS Number | 80763-86-6 | Molecular Weight | 704.64200 |
|---|
| Density | 1.48g/cm3 | Boiling Point | 893.3ºC at 760 mmHg |
|---|
| Molecular Formula | C36H28N6O10 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 494.1ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.48g/cm3 |
|---|
| Boiling Point | 893.3ºC at 760 mmHg |
|---|
| Molecular Formula | C36H28N6O10 |
|---|
| Molecular Weight | 704.64200 |
|---|
| Flash Point | 494.1ºC |
|---|
| Exact Mass | 704.18700 |
|---|
| PSA | 207.98000 |
|---|
| LogP | 3.04100 |
|---|
| Index of Refraction | 1.665 |
|---|
| InChIKey | ZLNMZWDQJJAEAM-UHFFFAOYSA-N |
|---|
| SMILES | O=C(NC1C(OC(=O)c2cccnc2)OC(COC(=O)c2cccnc2)C(OC(=O)c2cccnc2)C1OC(=O)c1cccnc1)c1cccnc1 |
|---|
