Introduction：Basic information about CAS 5339-59-3|Benzenesulfonamide, N,N-dibutyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenesulfonamide, N,N-dibutyl- |
|---|
| CAS Number | 5339-59-3 | Molecular Weight | 269.40300 |
|---|
| Density | 1.06g/cm3 | Boiling Point | 211-212ºC 17mm |
|---|
| Molecular Formula | C14H23NO2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | N,N-Dibutylbenzenesulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.06g/cm3 |
|---|
| Boiling Point | 211-212ºC 17mm |
|---|
| Molecular Formula | C14H23NO2S |
|---|
| Molecular Weight | 269.40300 |
|---|
| Exact Mass | 269.14500 |
|---|
| PSA | 45.76000 |
|---|
| LogP | 4.35830 |
|---|
| Index of Refraction | 1.509 |
|---|
| InChIKey | YKXINVWHNNYQMA-UHFFFAOYSA-N |
|---|
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ccccc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Safety Phrases | S24/25 |
|---|
| HS Code | 2935009090 |
|---|
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| N,N-dibutyl-benzenesulfonamide |
| N,N-dibutylbenzenesulfonamide |
| N,N-Dibutyl-benzolsulfonamid |
| N,N-Dibutylbenzenesulphonamide |
| dibutyl(phenylsulfonyl)amine |
| N,N-Bu2-Benzolsulfonamid |
| MFCD00151808 |
