Introduction:Basic information about CAS 116332-62-8|N-Methoxy-N-methyl-3-(trifluoromethyl)benzamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-Methoxy-N-methyl-3-(trifluoromethyl)benzamide |
|---|
| CAS Number | 116332-62-8 | Molecular Weight | 233.187 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 303.8±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H10F3NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 137.6±27.9 °C |
|---|
Names
| Name | N-methoxy-N-methyl-3-(trifluoromethyl)benzamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 303.8±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H10F3NO2 |
|---|
| Molecular Weight | 233.187 |
|---|
| Flash Point | 137.6±27.9 °C |
|---|
| Exact Mass | 233.066360 |
|---|
| PSA | 29.54000 |
|---|
| LogP | 2.49 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.468 |
|---|
| InChIKey | PAXXRRIUUCZPEU-UHFFFAOYSA-N |
|---|
| SMILES | CON(C)C(=O)c1cccc(C(F)(F)F)c1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
Synonyms
| 3-trifluoromethyl-(N-methyl-N-methoxy)benzamide |
| Benzamide, N-methoxy-N-methyl-3-(trifluoromethyl)- |
| N-Methoxy-N-methyl-3-(trifluoromethyl)benzamide |
| N-methoxy-N-methyl-3-trifluoromethyl-benzamide |
| N-methyl-N-methoxy-3-trifluoromethylbenzamide |
| 3-trifluoromethylbenzoic acid Weinreb amide |
| Benzamide,N-methoxy-N-methyl-3-(trifluoromethyl) |
| N-methyl-N-methoxy<3-(trifluoromethyl)phenyl>carboxamide |