Introduction：Basic information about CAS 121-95-9|Acetamide,N-methyl-N-(4-nitrophenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Acetamide,N-methyl-N-(4-nitrophenyl)- |
|---|
| CAS Number | 121-95-9 | Molecular Weight | 194.18700 |
|---|
| Density | 1.27g/cm3 | Boiling Point | 342.4ºC at 760mmHg |
|---|
| Molecular Formula | C9H10N2O3 | Melting Point | 153-154ºC |
|---|
| MSDS | / | Flash Point | 160.9ºC |
|---|
Names
| Name | N-Methyl-N-(4-nitrophenyl)acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.27g/cm3 |
|---|
| Boiling Point | 342.4ºC at 760mmHg |
|---|
| Melting Point | 153-154ºC |
|---|
| Molecular Formula | C9H10N2O3 |
|---|
| Molecular Weight | 194.18700 |
|---|
| Flash Point | 160.9ºC |
|---|
| Exact Mass | 194.06900 |
|---|
| PSA | 66.13000 |
|---|
| LogP | 2.10070 |
|---|
| Vapour Pressure | 7.54E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.592 |
|---|
| InChIKey | DKZFYTVXALXRSH-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)N(C)c1ccc([N+](=O)[O-])cc1 |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 4'-Nitro-N-methylacetoanilide |
| acetic acid-(N-methyl-4-nitro-anilide) |
| EINECS 204-511-1 |
| Essigsaeure-(N-methyl-4-nitro-anilid) |
| MFCD00035947 |
| N-(4-Nitrophenyl)-N-methylacetamide |
| N-methyl-4-nitroacetanilide |
| 4-nitro-N-methylacetanilide |
| N-Methyl-N-(4-nitro-phenyl)-acetamide |
| p-Nitro-N-methylacetanilide |
| N-Methyl-4-nitro-acetanilid |
