Introduction:Basic information about CAS 57353-93-2|4-(4-methoxyphenyl)-1-(2h)-phthalazinon&, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(4-methoxyphenyl)-1-(2h)-phthalazinon& |
|---|
| CAS Number | 57353-93-2 | Molecular Weight | 252.26800 |
|---|
| Density | 1.25g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C15H12N2O2 | Melting Point | 240-244ºC(lit.) |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-(4-methoxyphenyl)-1-(2h)-phthalazinon& |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.25g/cm3 |
|---|
| Melting Point | 240-244ºC(lit.) |
|---|
| Molecular Formula | C15H12N2O2 |
|---|
| Molecular Weight | 252.26800 |
|---|
| Exact Mass | 252.09000 |
|---|
| PSA | 54.98000 |
|---|
| LogP | 2.59870 |
|---|
| Index of Refraction | 1.637 |
|---|
| InChIKey | RYLLTTFNKPGBNO-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(-c2n[nH]c(=O)c3ccccc23)cc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| HS Code | 2933990090 |
|---|
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 4-(4-methoxyphenyl)-1,2-dihydrophthalazin-1-one |
| MFCD02660689 |
| 4-(4-Methoxy-phenyl)-butyronitril |
| 4-(p-methoxyphenyl)-phthalazin-1(2H)-one |
| 4-p-methoxyphenylphthalaz-1-one |
| 4-(4-methoxyphenyl)phthalazin-1(2H)-one |
| 4-Methoxybenzenebutanenitrile |
| 4-(4-Methoxy-phenyl)-2H-phthalazin-1-on |
| 4-(4-Methoxy-phenyl)-buttersaeure-nitril |
| 4-(p-methoxyphenyl)butyronitrile |
| Benzenebutanenitrile,4-methoxy |
| 4-(4-methoxy-phenyl)-butyronitrile |
| 4-(4-methoxyphenyl)-2H-phthalazin-1-one |