Introduction：Basic information about CAS 99662-46-1|Triphenyl(2-pyridylmethyl)phosphonium chloride hydrochloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Triphenyl(2-pyridylmethyl)phosphonium chloride hydrochloride |
|---|
| CAS Number | 99662-46-1 | Molecular Weight | 426.31800 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C24H22Cl2NP | Melting Point | 249-254ºC(lit.) |
|---|
| MSDS | USA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | Triphenyl(2-pyridylmethyl)phosphonium chloride hydrochloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 249-254ºC(lit.) |
|---|
| Molecular Formula | C24H22Cl2NP |
|---|
| Molecular Weight | 426.31800 |
|---|
| Exact Mass | 425.08700 |
|---|
| PSA | 26.48000 |
|---|
| LogP | 2.38170 |
|---|
| InChIKey | JHQWTRCLYUFMSJ-UHFFFAOYSA-M |
|---|
| SMILES | Cl.[Cl-].c1ccc([P+](Cc2ccccn2)(c2ccccc2)c2ccccc2)cc1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26;S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| MFCD00674065 |
| triphenyl(pyridin-2-ylmethyl)phosphanium,chloride,hydrochloride |
