Introduction:Basic information about CAS 910095-35-1|[2-[2-methyl-5-(trifluoromethyl)pyrazol-3-yl]phenyl]methanamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [2-[2-methyl-5-(trifluoromethyl)pyrazol-3-yl]phenyl]methanamine |
|---|
| CAS Number | 910095-35-1 | Molecular Weight | 255.23900 |
|---|
| Density | 1.31g/cm3 | Boiling Point | 120ºC/0.1mm |
|---|
| Molecular Formula | C12H12F3N3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 173.7ºC |
|---|
Names
| Name | [2-[2-methyl-5-(trifluoromethyl)pyrazol-3-yl]phenyl]methanamine |
|---|
Chemical & Physical Properties
| Density | 1.31g/cm3 |
|---|
| Boiling Point | 120ºC/0.1mm |
|---|
| Molecular Formula | C12H12F3N3 |
|---|
| Molecular Weight | 255.23900 |
|---|
| Flash Point | 173.7ºC |
|---|
| Exact Mass | 255.09800 |
|---|
| PSA | 43.84000 |
|---|
| LogP | 3.26490 |
|---|
| Index of Refraction | 1.547 |
|---|
| InChIKey | LAEYZMDFNCMFNX-UHFFFAOYSA-N |
|---|
| SMILES | Cn1nc(C(F)(F)F)cc1-c1ccccc1CN |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|