Introduction:Basic information about CAS 115250-38-9|(2R,3S,4S,5S)-5-Hydroxy-2,3,4-tris(phenylmethoxy)-5-[(phenylmethoxy)methyl]-c, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2R,3S,4S,5S)-5-Hydroxy-2,3,4-tris(phenylmethoxy)-5-[(phenylmethoxy)methyl]-cyclohexanone |
|---|
| CAS Number | 115250-38-9 | Molecular Weight | 552.657 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 681.9±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C35H36O6 | Melting Point | 84-85ºC |
|---|
| MSDS | / | Flash Point | 214.1±25.0 °C |
|---|
Names
| Name | (2R,3S,4S,5S)-5-hydroxy-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)cyclohexan-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 681.9±55.0 °C at 760 mmHg |
|---|
| Melting Point | 84-85ºC |
|---|
| Molecular Formula | C35H36O6 |
|---|
| Molecular Weight | 552.657 |
|---|
| Flash Point | 214.1±25.0 °C |
|---|
| Exact Mass | 552.251160 |
|---|
| PSA | 74.22000 |
|---|
| LogP | 8.46 |
|---|
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.624 |
|---|
| InChIKey | JWXHKWBUBUUEFP-SNSGHMKVSA-N |
|---|
| SMILES | O=C1CC(O)(COCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
|---|
Synonyms
| (2R,3S,4S,5S)-5-Hydroxy-2,3,4-tris(phenylmethoxy)-5-[(phenylmethoxy)methyl]-cyclohexanone |
| (2R,3S,4S,5S)-2,3,4-Tris(benzyloxy)-5-((benzyloxy)methyl)-5-hydroxycyclohexanone |
| (1S)-(1(OH),2,4/1,3)-2,3,4-Tri-O-benzyl-1-C-<(benzyloxy)methyl>-5-oxo-1,2,3,4-cyclohexanetetrol |
| (2R,3S,4S,5S)-2,3,4-Tris(benzyloxy)-5-[(benzyloxy)methyl]-5-hydroxycyclohexanone |
| (3S,4S,5S,2R)-5-hydroxy-5-[(phenylmethoxy)methyl]-2,3,4-tris(phenyl methoxy)cyclohexan-1-one |
| (1S)-(1(OH),2,4,5/1,3)-2,3,4-tri-O-benzyl-1-C-[benzyloxymethyl]-5-oxo-1,2,3,4-cyclohexanetetrol |
| Cyclohexanone, 5-hydroxy-2,3,4-tris(phenylmethoxy)-5-[(phenylmethoxy)methyl]-, (2R,3S,4S,5S)- |
| Cyclohexanone,5-hydroxy-2,3,4-tris(phenylmethoxy)-5-[(phenylmethoxy)methyl]-,(2R,3S,4S,5S) |
| tetra-O-benzyl valiolone |
| (1S)-(1(OH),2,4/1,3)-2,3,4-tri-O-benzyl-5-oxo-1-C-[benzyloxymethyl]-1,2,3,4-cyclohexanetetrol |