Introduction：Basic information about CAS 5459-63-2|Dimethyl 2,2'-dithiobisbenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dimethyl 2,2'-dithiobisbenzoate |
|---|
| CAS Number | 5459-63-2 | Molecular Weight | 334.41000 |
|---|
| Density | 1.34g/cm3 | Boiling Point | 443.5ºC at 760mmHg |
|---|
| Molecular Formula | C16H14O4S2 | Melting Point | 131-134℃ |
|---|
| MSDS | / | Flash Point | 215ºC |
|---|
Names
| Name | methyl 2-[(2-methoxycarbonylphenyl)disulfanyl]benzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.34g/cm3 |
|---|
| Boiling Point | 443.5ºC at 760mmHg |
|---|
| Melting Point | 131-134℃ |
|---|
| Molecular Formula | C16H14O4S2 |
|---|
| Molecular Weight | 334.41000 |
|---|
| Flash Point | 215ºC |
|---|
| Exact Mass | 334.03300 |
|---|
| PSA | 103.20000 |
|---|
| LogP | 4.05920 |
|---|
| Index of Refraction | 1.639 |
|---|
| InChIKey | NECMWXVJIUGCSW-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1ccccc1SSc1ccccc1C(=O)OC |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2930909090 |
|---|
Customs
| HS Code | 2930909090 |
|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Methyl 2-{[2-(methoxycarbonyl)phenyl]disulfanyl}benzoate |
| bis(2-methoxycarbonylphenyl) disulfide |
| methyl 2-(methoxycarbonylphenyl)disulfanylbenzoate |
| 2-carbomethoxyphenyl disulfide |
| Dimethyl-2,2'-Dithiosalicylate |
| bis(2-methoxycarbonylphenyl)sulfide |
| di-o-carbomethoxyphenyl disulfide |
| methyl 2,2'-dithiosalicylate |
| Dimethyl 2,2'-dithiobisbenzoate |
| methyl 2-{[2-(methoxycarbonyl)phenyl]dithio}benzoate |
| Dimethyl 2,2'-dithiodibenzoate |
