Introduction：Basic information about CAS 70918-01-3|Doxazosin hydrochloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Doxazosin hydrochloride |
|---|
| CAS Number | 70918-01-3 | Molecular Weight | 487.93600 |
|---|
| Density | / | Boiling Point | 718ºC at 760 mmHg |
|---|
| Molecular Formula | C23H26ClN5O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(2,3-dihydro-1,4-benzodioxin-3-yl)methanone,hydrochloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 718ºC at 760 mmHg |
|---|
| Molecular Formula | C23H26ClN5O5 |
|---|
| Molecular Weight | 487.93600 |
|---|
| Exact Mass | 487.16200 |
|---|
| PSA | 112.27000 |
|---|
| LogP | 3.10390 |
|---|
| InChIKey | AQAZIYFEPYHLHC-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc2nc(N3CCN(C(=O)C4COc5ccccc5O4)CC3)nc(N)c2cc1OC.Cl |
|---|
Synonyms
| Doxazosin hydrochloride |
| hydrochloride salt of Doxazosin |
| Doxazosin HCl |
| M364 |
| 4-amino-2-[4-(1,4-benzodioxan-2-carbonyl)piperazin-1-yl]-6,7-dimethoxyquinazoline hydrochloride |
