Introduction:Basic information about CAS 84-23-1|Naphth[1,2-d][1,2,3]oxadiazole-5-sulfonicacid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Naphth[1,2-d][1,2,3]oxadiazole-5-sulfonicacid |
|---|
| CAS Number | 84-23-1 | Molecular Weight | 250.23100 |
|---|
| Density | 1.671g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C10H6N2O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | benzo[e][1,2,3]benzoxadiazole-5-sulfonic acid |
|---|
Chemical & Physical Properties
| Density | 1.671g/cm3 |
|---|
| Molecular Formula | C10H6N2O4S |
|---|
| Molecular Weight | 250.23100 |
|---|
| Exact Mass | 250.00500 |
|---|
| PSA | 101.67000 |
|---|
| LogP | 2.70350 |
|---|
| Index of Refraction | 1.738 |
|---|
| InChIKey | WHHIIGNOLGKQPD-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(O)c1cc2onnc2c2ccccc12 |
|---|