Introduction：Basic information about CAS 5142-28-9|2-prop-2-enylsulfanyl-3,4,7,9-tetrazabicyclo[4.3.0]nona-1,6,8-triene-5-thione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-prop-2-enylsulfanyl-3,4,7,9-tetrazabicyclo[4.3.0]nona-1,6,8-triene-5-thione |
|---|
| CAS Number | 5142-28-9 | Molecular Weight | 224.30600 |
|---|
| Density | 1.54g/cm3 | Boiling Point | 311.6ºC at 760 mmHg |
|---|
| Molecular Formula | C8H8N4S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 142.3ºC |
|---|
Names
| Name | 7-prop-2-enylsulfanyl-5,6-dihydroimidazo[4,5-d]pyridazine-4-thione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.54g/cm3 |
|---|
| Boiling Point | 311.6ºC at 760 mmHg |
|---|
| Molecular Formula | C8H8N4S2 |
|---|
| Molecular Weight | 224.30600 |
|---|
| Flash Point | 142.3ºC |
|---|
| Exact Mass | 224.01900 |
|---|
| PSA | 114.75000 |
|---|
| LogP | 2.29360 |
|---|
| Index of Refraction | 1.787 |
|---|
| InChIKey | VLNWOZJSFXDEMI-UHFFFAOYSA-N |
|---|
| SMILES | C=CCSc1n[nH]c(=S)c2nc[nH]c12 |
|---|
Synonyms
| 4-(Allylthio)-1H-imidazo[4,5-d]pyridazine-7-thiol |
| 4-(Allylthio)-1H-imidazo[4,5-d]pyridazin-7-yl hydrosulfide |
