Introduction：Basic information about CAS 901-44-0|2,2-Bis(4-(2-hydroxyethoxy)phenyl)propane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2-Bis(4-(2-hydroxyethoxy)phenyl)propane |
|---|
| CAS Number | 901-44-0 | Molecular Weight | 316.392 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 495.0±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H24O4 | Melting Point | 112ºC |
|---|
| MSDS | / | Flash Point | 253.1±28.7 °C |
|---|
Names
| Name | Ethanol, 2,2'-[isopropylidenebis(p-phenyleneoxy)]di |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 495.0±45.0 °C at 760 mmHg |
|---|
| Melting Point | 112ºC |
|---|
| Molecular Formula | C19H24O4 |
|---|
| Molecular Weight | 316.392 |
|---|
| Flash Point | 253.1±28.7 °C |
|---|
| Exact Mass | 316.167450 |
|---|
| PSA | 58.92000 |
|---|
| LogP | 2.79 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.560 |
|---|
| InChIKey | UUAGPGQUHZVJBQ-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(c1ccc(OCCO)cc1)c1ccc(OCCO)cc1 |
|---|
Synonyms
| 2,2'-[propane-2,2-diylbis(benzene-4,1-diyloxy)]diethanol |
| 2,2'-(Isopropylidenebis(p-phenyleneoxy))diethanol |
| 2,2'-[2,2-Propanediylbis(4,1-phenyleneoxy)]diethanol |
| 2,2'-[propane-2,2-diylbis(4,1-phenyleneoxy)]diethanol |
| 2,2-Bis(p-(β-hydroxyethoxy)phenyl)propane |
| 2,2-Bis(4-(2-hydroxyethoxy)phenyl)propane |
| Bisphenol A ethoxylate |
| 2,2-Bis(p-(2-hydroxyethoxy)phenyl)propane |
| Ethanol, 2,2'-((1-methylethylidene)bis(4,1-phenyleneoxy))bis- |
| 2,2-Bis[4-(2-hydroxyethoxy)phenyl]propane |
| Ethanol, 2,2'-[(1-methylethylidene)bis(4,1-phenyleneoxy)]bis- |
| ethylene oxide 2-mol adduct of bisphenol A |
| EINECS 212-985-6 |
| BPAEE |
