Introduction：Basic information about CAS 86604-43-5|2-[1-(3-methoxyphenyl)ethylidene]propanedinitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[1-(3-methoxyphenyl)ethylidene]propanedinitrile |
|---|
| CAS Number | 86604-43-5 | Molecular Weight | 198.22100 |
|---|
| Density | 1.117g/cm3 | Boiling Point | 332.1ºC at 760 mmHg |
|---|
| Molecular Formula | C12H10N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 135ºC |
|---|
Names
| Name | 2-[1-(3-methoxyphenyl)ethylidene]propanedinitrile |
|---|
Chemical & Physical Properties
| Density | 1.117g/cm3 |
|---|
| Boiling Point | 332.1ºC at 760 mmHg |
|---|
| Molecular Formula | C12H10N2O |
|---|
| Molecular Weight | 198.22100 |
|---|
| Flash Point | 135ºC |
|---|
| Exact Mass | 198.07900 |
|---|
| PSA | 56.81000 |
|---|
| LogP | 2.51586 |
|---|
| Index of Refraction | 1.548 |
|---|
| InChIKey | KSTYFPHNAZISJF-UHFFFAOYSA-N |
|---|
| SMILES | COc1cccc(C(C)=C(C#N)C#N)c1 |
|---|
