Introduction:Basic information about CAS 57610-10-3|Benzene,2-methyl-4-nitro-1-nitroso-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzene,2-methyl-4-nitro-1-nitroso- |
|---|
| CAS Number | 57610-10-3 | Molecular Weight | 166.13400 |
|---|
| Density | 1.34g/cm3 | Boiling Point | 324.6ºC at 760mmHg |
|---|
| Molecular Formula | C7H6N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 150.1ºC |
|---|
Names
| Name | 2-methyl-4-nitro-1-nitrosobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.34g/cm3 |
|---|
| Boiling Point | 324.6ºC at 760mmHg |
|---|
| Molecular Formula | C7H6N2O3 |
|---|
| Molecular Weight | 166.13400 |
|---|
| Flash Point | 150.1ºC |
|---|
| Exact Mass | 166.03800 |
|---|
| PSA | 75.25000 |
|---|
| LogP | 2.82430 |
|---|
| Index of Refraction | 1.591 |
|---|
| InChIKey | BJYRPJHNDONQKN-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc([N+](=O)[O-])ccc1N=O |
|---|
Synonyms
| 2-nitroso-5-nitrotoluene |
| 2-methyl-4-nitro-1-nitroso-benzene |
| 5-nitro-2-nitroso-toluene |
| 5-Nitro-2-nitroso-toluol |
| Benzene,2-methyl-4-nitro-1-nitroso |