Introduction：Basic information about CAS 90610-57-4|1H-Pyrrole-2,4-dicarboxylicacid, 3-methyl-, 2-ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Pyrrole-2,4-dicarboxylicacid, 3-methyl-, 2-ethyl ester |
|---|
| CAS Number | 90610-57-4 | Molecular Weight | 197.18800 |
|---|
| Density | 1.306g/cm3 | Boiling Point | 391.5ºC at 760mmHg |
|---|
| Molecular Formula | C9H11NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 190.6ºC |
|---|
Names
| Name | 5-ethoxycarbonyl-4-methyl-1H-pyrrole-3-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.306g/cm3 |
|---|
| Boiling Point | 391.5ºC at 760mmHg |
|---|
| Molecular Formula | C9H11NO4 |
|---|
| Molecular Weight | 197.18800 |
|---|
| Flash Point | 190.6ºC |
|---|
| Exact Mass | 197.06900 |
|---|
| PSA | 79.39000 |
|---|
| LogP | 1.19800 |
|---|
| Index of Refraction | 1.56 |
|---|
| InChIKey | MGEYWENIZONWLZ-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1[nH]cc(C(=O)O)c1C |
|---|
Synonyms
| 3-methyl-pyrrole-2,4-dicarboxylic acid-2-ethyl ester |
| 3-Methyl-pyrrol-2,4-dicarbonsaeure-2-aethylester |
| 2-Ethoxycarbonyl-3-methyl pyrrol-4-carboxylic acid |
