Introduction:Basic information about CAS 4097-50-1|Phenol,4-(1,1-dimethylpropyl)-2,6-dinitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Phenol,4-(1,1-dimethylpropyl)-2,6-dinitro- |
|---|
| CAS Number | 4097-50-1 | Molecular Weight | 254.23900 |
|---|
| Density | 1.305g/cm3 | Boiling Point | 291.1ºC at 760mmHg |
|---|
| Molecular Formula | C11H14N2O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 115.3ºC |
|---|
Names
| Name | 4-(2-methylbutan-2-yl)-2,6-dinitrophenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.305g/cm3 |
|---|
| Boiling Point | 291.1ºC at 760mmHg |
|---|
| Molecular Formula | C11H14N2O5 |
|---|
| Molecular Weight | 254.23900 |
|---|
| Flash Point | 115.3ºC |
|---|
| Exact Mass | 254.09000 |
|---|
| PSA | 111.87000 |
|---|
| LogP | 3.94260 |
|---|
| Index of Refraction | 1.573 |
|---|
| InChIKey | BTFCDCNHRPIDHR-UHFFFAOYSA-N |
|---|
| SMILES | CCC(C)(C)c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
Customs
| HS Code | 2908999090 |
|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 2,6-Dinitro-4-t-amylphenol |
| 3.5-Dinitro-4-hydroxy-1-tert.-pentyl-benzol |
| 2,6-dinitro-4-tert-pentyl-phenol |
| 4-tert-amyl-2,6-dinitrophenol |
| 4-tert-anyl-2,6-dinitrophenol |
| 3.5-Dinitro-4-oxy-1-tert.-amyl-benzol |
| 2.6-Dinitro-4-tert.-amyl-phenol |