Introduction：Basic information about CAS 5344-48-9|Potassium 4-nitro-2-sulfobenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Potassium 4-nitro-2-sulfobenzoate |
|---|
| CAS Number | 5344-48-9 | Molecular Weight | 285.272 |
|---|
| Density | 1.809 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C7H4KNO7S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | potassium,4-nitro-2-sulfobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.809 g/cm3 |
|---|
| Molecular Formula | C7H4KNO7S |
|---|
| Molecular Weight | 285.272 |
|---|
| Exact Mass | 284.934540 |
|---|
| PSA | 148.70000 |
|---|
| LogP | 1.80110 |
|---|
| Index of Refraction | 1.643 |
|---|
| InChIKey | LDDPHQAIEFBCTC-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc([N+](=O)[O-])cc1S(=O)(=O)O.[K] |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2-Carboxy-5-nitrobenzenesulfonic acid potassium salt |
| 4-nitro-2-sulfo-benzoic acid,monopotassium salt |
| Potassium 4-nitro-2-sulfobenzoate |
| WSQR BVQ ENW & &K salt |
| Benzoic acid,potassiumsulfonate salt |
| Benzoic acid, 4-nitro-2-sulfo-, potassium salt (1:1) |
| potassium 4-nitro-2-sulfobenzoic acid |
| 2-carboxy-5-nitrobenzenesulfonic acid monopotassium salt |
