Introduction:Basic information about CAS 3062-53-1|Benzene,2-(2-bromoethoxy)-1-chloro-4-nitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzene,2-(2-bromoethoxy)-1-chloro-4-nitro- |
|---|
| CAS Number | 3062-53-1 | Molecular Weight | 280.50300 |
|---|
| Density | 1.68g/cm3 | Boiling Point | 369.2ºC at 760mmHg |
|---|
| Molecular Formula | C8H7BrClNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 177.1ºC |
|---|
Names
| Name | 2-(2-bromoethoxy)-1-chloro-4-nitrobenzene |
|---|
Chemical & Physical Properties
| Density | 1.68g/cm3 |
|---|
| Boiling Point | 369.2ºC at 760mmHg |
|---|
| Molecular Formula | C8H7BrClNO3 |
|---|
| Molecular Weight | 280.50300 |
|---|
| Flash Point | 177.1ºC |
|---|
| Exact Mass | 278.93000 |
|---|
| PSA | 55.05000 |
|---|
| LogP | 3.54510 |
|---|
| Index of Refraction | 1.595 |
|---|
| InChIKey | LGPJVUMRHGXFME-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(Cl)c(OCCBr)c1 |
|---|