Introduction:Basic information about CAS 144913-06-4|3-(benzylamino)-4-ethoxycyclobut-3-ene-1,2-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(benzylamino)-4-ethoxycyclobut-3-ene-1,2-dione |
|---|
| CAS Number | 144913-06-4 | Molecular Weight | 231.24700 |
|---|
| Density | 1.23g/cm3 | Boiling Point | 396ºC at 760 mmHg |
|---|
| Molecular Formula | C13H13NO3 | Melting Point | 68ºC |
|---|
| MSDS | / | Flash Point | 193.3ºC |
|---|
Names
| Name | 3-(benzylamino)-4-ethoxycyclobut-3-ene-1,2-dione |
|---|
Chemical & Physical Properties
| Density | 1.23g/cm3 |
|---|
| Boiling Point | 396ºC at 760 mmHg |
|---|
| Melting Point | 68ºC |
|---|
| Molecular Formula | C13H13NO3 |
|---|
| Molecular Weight | 231.24700 |
|---|
| Flash Point | 193.3ºC |
|---|
| Exact Mass | 231.09000 |
|---|
| PSA | 55.40000 |
|---|
| LogP | 1.56700 |
|---|
| Vapour Pressure | 1.77E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.577 |
|---|
| InChIKey | JFBJJNQPIJHMPP-UHFFFAOYSA-N |
|---|
| SMILES | CCOc1c(NCc2ccccc2)c(=O)c1=O |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|