CAS 21652-58-4|(perfluoro-n-octyl)ethylene
Introduction:Basic information about CAS 21652-58-4|(perfluoro-n-octyl)ethylene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (perfluoro-n-octyl)ethylene | ||
|---|---|---|---|
| CAS Number | 21652-58-4 | Molecular Weight | 446.104 |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 144.6±8.0 °C at 760 mmHg |
| Molecular Formula | C10H3F17 | Melting Point | / |
| MSDS | ChineseUSA | Flash Point | 51.1±0.0 °C |
| Symbol | GHS07 | Signal Word | Warning |
Names
| Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodec-1-ene |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 144.6±8.0 °C at 760 mmHg |
| Molecular Formula | C10H3F17 |
| Molecular Weight | 446.104 |
| Flash Point | 51.1±0.0 °C |
| Exact Mass | 445.996338 |
| LogP | 7.66 |
| Vapour Pressure | 6.4±0.3 mmHg at 25°C |
| Index of Refraction | 1.287 |
| InChIKey | NKAMGQZDVMQEJL-UHFFFAOYSA-N |
| SMILES | C=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
Safety Information
| Symbol | GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | 1993 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 3.2 |
| HS Code | 2903399090 |
Customs
| HS Code | 2903399090 |
|---|---|
| Summary | 2903399090. brominated,fluorinated or iodinated derivatives of acyclic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
Synonyms
| 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluorodecene |
| 1-Decene, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro- |
| 1H,1H,2H-perfluorodec-1-ene |
| 1H,1H,2H-Heptadecafluoro-1-decene |
| EINECS 244-503-5 |
| 1H,1H,2H-Perfluoro-1-decene |
| 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluoro-1-decene |
| (perfluoro-n-octyl)ethylene |
| 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluorodec-1-ene |
| MFCD00039246 |
| tridecafluoro 1-decene |
