Introduction:Basic information about CAS 54057-46-4|4-[(4-fluorobenzoyl)amino]benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[(4-fluorobenzoyl)amino]benzoic acid |
|---|
| CAS Number | 54057-46-4 | Molecular Weight | 259.23300 |
|---|
| Density | 1.4g/cm3 | Boiling Point | 360.2ºC at 760 mmHg |
|---|
| Molecular Formula | C14H10FNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 171.7ºC |
|---|
Names
| Name | 4-[(4-fluorobenzoyl)amino]benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4g/cm3 |
|---|
| Boiling Point | 360.2ºC at 760 mmHg |
|---|
| Molecular Formula | C14H10FNO3 |
|---|
| Molecular Weight | 259.23300 |
|---|
| Flash Point | 171.7ºC |
|---|
| Exact Mass | 259.06400 |
|---|
| PSA | 66.40000 |
|---|
| LogP | 2.84920 |
|---|
| Index of Refraction | 1.653 |
|---|
| InChIKey | JPAADGLYGIWZGO-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc(NC(=O)c2ccc(F)cc2)cc1 |
|---|
Synonyms
| 4-(4-fluorobenzamido)benzoic acid |
| 4-(4-fluorobenzoylamino)benzoic acid |