Introduction:Basic information about CAS 599-62-2|Benzenesulfonamide, N,4-dimethyl-N-phenyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenesulfonamide, N,4-dimethyl-N-phenyl- |
|---|
| CAS Number | 599-62-2 | Molecular Weight | 261.33900 |
|---|
| Density | 1.224g/cm3 | Boiling Point | 391.7ºC at 760 mmHg |
|---|
| Molecular Formula | C14H15NO2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 190.7ºC |
|---|
Names
| Name | N,4-dimethyl-N-phenylbenzenesulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.224g/cm3 |
|---|
| Boiling Point | 391.7ºC at 760 mmHg |
|---|
| Molecular Formula | C14H15NO2S |
|---|
| Molecular Weight | 261.33900 |
|---|
| Flash Point | 190.7ºC |
|---|
| Exact Mass | 261.08200 |
|---|
| PSA | 45.76000 |
|---|
| LogP | 3.90090 |
|---|
| Index of Refraction | 1.604 |
|---|
| InChIKey | HEFFCQILGLLHQC-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)N(C)c2ccccc2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| 4,N-dimethyl-N-phenyl-benzenesulfonamide |
| 4-methyl-N-methyl-N-phenylbenzenesulfonamide |
| N-methyl-N-phenyl-p-toluenesulfonamide |
| Benzenesulfonamide,N,4-dimethyl-N-phenyl |
| Benzenesulfonamide,4-dimethyl-N-phenyl |
| N-methyl-toluene-4-sulfonanilide |
| N-phenyl-N-methyl-toluenesulfonamide |