Introduction:Basic information about CAS 147636-36-0|1-[(4-methylphenyl)sulfonyl]-4-piperidinecarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-[(4-methylphenyl)sulfonyl]-4-piperidinecarboxylic acid |
|---|
| CAS Number | 147636-36-0 | Molecular Weight | 283.34300 |
|---|
| Density | 1.328g/cm3 | Boiling Point | 477.6ºC at 760mmHg |
|---|
| Molecular Formula | C13H17NO4S | Melting Point | 167-169ºC |
|---|
| MSDS | / | Flash Point | 242.6ºC |
|---|
Names
| Name | 1-(4-methylphenyl)sulfonylpiperidine-4-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.328g/cm3 |
|---|
| Boiling Point | 477.6ºC at 760mmHg |
|---|
| Melting Point | 167-169ºC |
|---|
| Molecular Formula | C13H17NO4S |
|---|
| Molecular Weight | 283.34300 |
|---|
| Flash Point | 242.6ºC |
|---|
| Exact Mass | 283.08800 |
|---|
| PSA | 83.06000 |
|---|
| LogP | 2.49900 |
|---|
| Vapour Pressure | 6.28E-10mmHg at 25°C |
|---|
| InChIKey | YJRQMKSUAIKDDF-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C(=O)O)CC2)cc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1-tosylpiperidine-4-carboxylic acid |
| 1-(toluene-4-sulfonyl)-piperidine-4-carboxylic acid |
| 1-[(4-Methylphenyl)sulfonyl]-4-piperidinecarboxylic acid |
| F0306-0037 |
| 4-Piperidinecarboxylicacid,1-[(4-methylphenyl)sulfonyl] |
| 1-(4-toluenesulfonyl)-piperidine-4-carboxylic acid |
| 1-(4-methylphenylsulfonyl)piperidine-4-carboxylic acid |
| MFCD00723645 |
| 1-(Toluol-4-sulfonyl)-piperidin-4-carbonsaeure |