Introduction：Basic information about CAS 35677-89-5|N-Cbz-L-homoserine lactone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-Cbz-L-homoserine lactone |
|---|
| CAS Number | 35677-89-5 | Molecular Weight | 235.236 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 466.1±44.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H13NO4 | Melting Point | 127-132ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 235.7±28.4 °C |
|---|
Names
| Name | benzyl N-[(3S)-2-oxooxolan-3-yl]carbamate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 466.1±44.0 °C at 760 mmHg |
|---|
| Melting Point | 127-132ºC |
|---|
| Molecular Formula | C12H13NO4 |
|---|
| Molecular Weight | 235.236 |
|---|
| Flash Point | 235.7±28.4 °C |
|---|
| Exact Mass | 235.084457 |
|---|
| PSA | 64.63000 |
|---|
| LogP | 0.61 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.561 |
|---|
| InChIKey | FKWDZIFOVOUDAG-JTQLQIEISA-N |
|---|
| SMILES | O=C(NC1CCOC1=O)OCc1ccccc1 |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | Xn |
|---|
| Safety Phrases | 22-24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2932209090 |
|---|
Customs
| HS Code | 2932209090 |
|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2(S)-2-(benzyloxycarbonylamino)-4-butyrolactone |
| (S)-Benzyl (2-oxotetrahydrofuran-3-yl)carbamate |
| Carbamic acid, N-[(3S)-tetrahydro-2-oxo-3-furanyl]-, phenylmethyl ester |
| N-Carbobenzoxy-L-homoserine Lactone |
| Cbz-L-Homoserine lactone |
| benzyl[(3s)-2-oxotetrahydrofuran-3-yl]carbamate |
| Z-L-homoserine lactone |
| (S)-α-(Carbobenzoxyamino)-γ-butyrolactone |
| (S)-benzyl 2-oxotetrahydrofuran-3-ylcarbamate |
| N-Cbz-L-HSL |
| L-2-<(benzyloxycarbonyl)amino>-4-butyrolactone |
| Cbz-L-Homoserinelactone |
| N-Z-L-Homoserine lactone |
| N-Cbz-L-homoserine lactone |
| (S)-α-(Cbz-amino)-γ-butyrolactone |
| MFCD00674555 |
| Benzyl [(3S)-2-oxotetrahydro-3-furanyl]carbamate |
| Benzyl [(3S)-2-oxotetrahydrofuran-3-yl]carbamate |
