Introduction:Basic information about CAS 879996-69-7|3-(3-fluorophenyl)-1h-pyrazole-4-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(3-fluorophenyl)-1h-pyrazole-4-carboxylic acid |
|---|
| CAS Number | 879996-69-7 | Molecular Weight | 206.17300 |
|---|
| Density | 1.442g/cm3 | Boiling Point | 429.668ºC at 760 mmHg |
|---|
| Molecular Formula | C10H7FN2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 213.655ºC |
|---|
Names
| Name | 5-(3-fluorophenyl)-1H-pyrazole-4-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.442g/cm3 |
|---|
| Boiling Point | 429.668ºC at 760 mmHg |
|---|
| Molecular Formula | C10H7FN2O2 |
|---|
| Molecular Weight | 206.17300 |
|---|
| Flash Point | 213.655ºC |
|---|
| Exact Mass | 206.04900 |
|---|
| PSA | 65.98000 |
|---|
| LogP | 1.91400 |
|---|
| Index of Refraction | 1.621 |
|---|
| InChIKey | HJVSMYJDZQWISE-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cn[nH]c1-c1cccc(F)c1 |
|---|
Synonyms
| 3-(3-Fluorophenyl)-1H-pyrazole-4-carboxylic acid |
| 3-(3-fluorophenyl)pyrazole-4-carboxylic acid |