Introduction：Basic information about CAS 40913-92-6|4-(Methanesulfonyl)benzoyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(Methanesulfonyl)benzoyl chloride |
|---|
| CAS Number | 40913-92-6 | Molecular Weight | 218.65700 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C8H7ClO3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-methylsulfonylbenzoyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C8H7ClO3S |
|---|
| Molecular Weight | 218.65700 |
|---|
| Exact Mass | 217.98000 |
|---|
| PSA | 59.59000 |
|---|
| LogP | 2.54990 |
|---|
| InChIKey | IPEIDGXNXFPGBG-UHFFFAOYSA-N |
|---|
| SMILES | CS(=O)(=O)c1ccc(C(=O)Cl)cc1 |
|---|
Safety Information
| Hazard Codes | C |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 4-methanesulfonylbenzoyl chloride |
| p-(methylsulfonyl)benzoyl chloride |
| Benzoyl chloride,4-(methylsulfonyl) |
| 4-(methylsulfonyl)benzoyl chloride |
| 4-(methylsulphonyl)benzoyl chloride |
