Introduction：Basic information about CAS 14906-37-7|Ethyl isonicotinate 1-oxide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl isonicotinate 1-oxide |
|---|
| CAS Number | 14906-37-7 | Molecular Weight | 167.16200 |
|---|
| Density | 1.16 g/cm3 | Boiling Point | 345.8ºC at 760 mmHg |
|---|
| Molecular Formula | C8H9NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 345.8±15.0 °C(Predicted) |
|---|
Names
| Name | ethyl 1-oxidopyridin-1-ium-4-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.16 g/cm3 |
|---|
| Boiling Point | 345.8ºC at 760 mmHg |
|---|
| Molecular Formula | C8H9NO3 |
|---|
| Molecular Weight | 167.16200 |
|---|
| Flash Point | 345.8±15.0 °C(Predicted) |
|---|
| Exact Mass | 167.05800 |
|---|
| PSA | 51.76000 |
|---|
| LogP | 1.29180 |
|---|
| Vapour Pressure | 6.03E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.52 |
|---|
| InChIKey | DPWRGNWJVVSVIE-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc[n+]([O-])cc1 |
|---|
Safety Information
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| isonicotinic acid N-oxide ethyl ester |
| Isonicotinicacid,ethyl ester,1-oxide (6CI,8CI) |
| ethyl isonocotinate N-oxide |
| Ethyl isonicotinate oxide |
| Ethyl isonicotinate 1-oxide |
| 1-Oxy-isonicotinsaeure-aethylester |
| 4-Pyridinecarboxylicacid,ethyl ester,1-oxide |
| Ethyl pyridine-4-carboxylateN-oxide |
| 4-ethoxycarbonylpyridine 1-oxide |
| 4-ethoxycarbonylpyridine N-oxide |
| 1-oxy-isonicotinic acid ethyl ester |
| 4-Carbethoxypyridine 1-oxide |
| Ethylisonicotinate N-oxide |
