Introduction:Basic information about CAS 191729-02-9|2-Chloro-4-(4-methoxyphenylamino)pyrimidine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Chloro-4-(4-methoxyphenylamino)pyrimidine |
|---|
| CAS Number | 191729-02-9 | Molecular Weight | 235.67000 |
|---|
| Density | 1.324g/cm3 | Boiling Point | 436.9ºC at 760 mmHg |
|---|
| Molecular Formula | C11H10ClN3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 218ºC |
|---|
Names
| Name | 2-Chloro-N-(4-methoxyphenyl)pyrimidin-4-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.324g/cm3 |
|---|
| Boiling Point | 436.9ºC at 760 mmHg |
|---|
| Molecular Formula | C11H10ClN3O |
|---|
| Molecular Weight | 235.67000 |
|---|
| Flash Point | 218ºC |
|---|
| Exact Mass | 235.05100 |
|---|
| PSA | 47.04000 |
|---|
| LogP | 2.95520 |
|---|
| Vapour Pressure | 7.8E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.631 |
|---|
| InChIKey | SEAAMKRQIGYXRB-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(Nc2ccnc(Cl)n2)cc1 |
|---|
Synonyms
| 2-Chloro-4-(4-methoxyphenylamino)pyrimidine |
| 2-chloro-4-(4-methoxyanilino)pyrimidine |
| 2-chloro-N-(4-methoxyphenyl)-4-pyrimidineamine |