Introduction：Basic information about CAS 205126-71-2|Boc-L-4-Carbamoylphe, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Boc-L-4-Carbamoylphe |
|---|
| CAS Number | 205126-71-2 | Molecular Weight | 308.33000 |
|---|
| Density | 1.247g/cm3 | Boiling Point | 534.083°C at 760 mmHg |
|---|
| Molecular Formula | C15H20N2O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 276.804°C |
|---|
Names
| Name | (2S)-3-(4-carbamoylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.247g/cm3 |
|---|
| Boiling Point | 534.083°C at 760 mmHg |
|---|
| Molecular Formula | C15H20N2O5 |
|---|
| Molecular Weight | 308.33000 |
|---|
| Flash Point | 276.804°C |
|---|
| Exact Mass | 308.13700 |
|---|
| PSA | 118.72000 |
|---|
| LogP | 2.39710 |
|---|
| Index of Refraction | 1.555 |
|---|
| InChIKey | OJOCXVKXBATIDB-NSHDSACASA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(C(N)=O)cc1)C(=O)O |
|---|
Synonyms
| BL546-1 |
| Boc-L-4-Carbamoylphenylalanine |
| Boc-L-4-Carbamoylphe |
| 4-Carbamoyl-N-{[(2-Methyl-2-Propanyl)Oxy]Carbonyl}-L-Phenylalanine |
