Introduction:Basic information about CAS 205526-23-4|Fmoc-3-chloro-D-phenylalanine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fmoc-3-chloro-D-phenylalanine |
|---|
| CAS Number | 205526-23-4 | Molecular Weight | 421.873 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 640.9±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C24H20ClNO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 341.4±31.5 °C |
|---|
Names
| Name | (2R)-3-(3-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 640.9±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C24H20ClNO4 |
|---|
| Molecular Weight | 421.873 |
|---|
| Flash Point | 341.4±31.5 °C |
|---|
| Exact Mass | 421.108093 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 6.00 |
|---|
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.638 |
|---|
| InChIKey | UOZAKKJRIKXQPY-JOCHJYFZSA-N |
|---|
| SMILES | O=C(NC(Cc1cccc(Cl)c1)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
|---|
| Storage condition | Store at 0°C |
|---|
Safety Information
Synonyms
| Fmoc-D-3-chloroPhe-OH |
| fmoc-l-3-chlorophe |
| (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(3-chlorophenyl)propanoic acid |
| FMOC-D-3-CHLOROPHE |
| (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(3-chlorophenyl)propanoic acid |
| AmbotzFAA1679 |
| MFCD00672549 |
| Fmoc-3-chloro-D-phenylalanine |
| Fmoc-D-3-chlorophenylalanine |
| 3-Chloro-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-phenylalanine |
| (2S)-3-(3-Chlorophenyl)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}propanoic acid |
| Fmoc-L-3-Chlorophenylalanine |
| fmoc-l-3-chloro-phe-oh |
| fmoc-3-chloro-l-phenylalanine |
| L-Phenylalanine, 3-chloro-N-[(9H-fluoren-9-ylmethoxy)carbonyl]- |
| Fmoc-3-Chloro-D-Phe-OH |