Introduction:Basic information about CAS 20585-34-6|(S)-2-Cyclohexyl-2-phenylglycolic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-2-Cyclohexyl-2-phenylglycolic acid |
|---|
| CAS Number | 20585-34-6 | Molecular Weight | 234.291 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 408.6±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H18O3 | Melting Point | 142-143 ºC (dichloromethane hexane ) |
|---|
| MSDS | / | Flash Point | 215.1±19.7 °C |
|---|
Names
| Name | (S)-2-Cyclohexyl-2-hydroxy-phenylacetic Acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 408.6±25.0 °C at 760 mmHg |
|---|
| Melting Point | 142-143 ºC (dichloromethane hexane ) |
|---|
| Molecular Formula | C14H18O3 |
|---|
| Molecular Weight | 234.291 |
|---|
| Flash Point | 215.1±19.7 °C |
|---|
| Exact Mass | 234.125595 |
|---|
| PSA | 57.53000 |
|---|
| LogP | 3.33 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.574 |
|---|
| InChIKey | YTRNSQPXEDGWMR-CQSZACIVSA-N |
|---|
| SMILES | O=C(O)C(O)(c1ccccc1)C1CCCCC1 |
|---|
| Water Solubility | Very slightly soluble (0.68 g/L) (25 ºC) |
|---|
Safety Information
Customs
| HS Code | 2918199090 |
|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| (2S)-Cyclohexyl(hydroxy)phenylacetic acid |
| |A-cyclohexylmandelic acid |
| Cyclohexylphenylglycolic acid |
| 2-cyclohexylmandelic acid |
| Benzeneacetic acid, α-cyclohexyl-α-hydroxy-, (αS)- |
| Lespedamine |
| (S)-2-cyclohexyl-2-phenylglycolic acid |
| Hexahydrobenzilic acid |
| Cyclohexylmandelic acid |