Introduction：Basic information about CAS 2062-26-2|2-(Trifluoromethyl)cinnamic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(Trifluoromethyl)cinnamic acid |
|---|
| CAS Number | 2062-26-2 | Molecular Weight | 216.157 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 279.2±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H7F3O2 | Melting Point | 231-233ºC(lit.) |
|---|
| MSDS | / | Flash Point | 122.6±25.9 °C |
|---|
Names
| Name | 2-(Trifluoromethyl)cinnamic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 279.2±35.0 °C at 760 mmHg |
|---|
| Melting Point | 231-233ºC(lit.) |
|---|
| Molecular Formula | C10H7F3O2 |
|---|
| Molecular Weight | 216.157 |
|---|
| Flash Point | 122.6±25.9 °C |
|---|
| Exact Mass | 216.039810 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 3.37 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.526 |
|---|
| InChIKey | ANRMAUMHJREENI-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C=Cc1ccc(C(F)(F)F)cc1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-37/39 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| 3-[4-(Trifluoromethyl)phenyl]acrylic acid |
| trans-4-hydroxy-4'-pentyl-1,1'-bicyclohexane |
| EINECS 218-169-6 |
| 2-Propenoic acid, 3-[4-(trifluoromethyl)phenyl]-, (2E)- |
| 4-(Trifluoromethyl)cinnamic acid |
| MFCD00002696 |
| 2-propenoic acid, 3-[4-(trifluoromethyl)phenyl]- |
