Introduction：Basic information about CAS 20440-94-2|4,4-Dimethoxy-triphenylamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,4-Dimethoxy-triphenylamine |
|---|
| CAS Number | 20440-94-2 | Molecular Weight | 305.37000 |
|---|
| Density | 1.136 | Boiling Point | 453.4±30.0 ℃(Predicted) |
|---|
| Molecular Formula | C20H19NO2 | Melting Point | 103 ℃ |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-Methoxy-N-(4-methoxyphenyl)-N-phenylaniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.136 |
|---|
| Boiling Point | 453.4±30.0 ℃(Predicted) |
|---|
| Melting Point | 103 ℃ |
|---|
| Molecular Formula | C20H19NO2 |
|---|
| Molecular Weight | 305.37000 |
|---|
| Exact Mass | 305.14200 |
|---|
| PSA | 21.70000 |
|---|
| LogP | 5.17360 |
|---|
| InChIKey | ZJPTYHDCQPDNBH-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(N(c2ccccc2)c2ccc(OC)cc2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2922299090 |
|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 4-methoxy-N-(4-methoxyphenyl)-N-phenylamine |
| bis(4-methoxyphenyl)phenylamine |
| N,N-bis(4-methoxylphenyl)-N-phenylamine |
| N,N-bis(4-methoxyphenyl)-N-phenylamine |
| N,N-di(4-methoxyphenyl)aniline |
| [di(4-methoxyphenyl)](phenyl)amine |
| N,N-di(4-methoxyphenyl)phenylamine |
