Introduction:Basic information about CAS 59748-14-0|4'-Butoxy-4-biphenylcarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4'-Butoxy-4-biphenylcarboxylic acid |
|---|
| CAS Number | 59748-14-0 | Molecular Weight | 270.323 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 438.0±38.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H18O3 | Melting Point | 267-268ºC |
|---|
| MSDS | / | Flash Point | 159.7±20.3 °C |
|---|
Names
| Name | 4-(4-butoxyphenyl)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 438.0±38.0 °C at 760 mmHg |
|---|
| Melting Point | 267-268ºC |
|---|
| Molecular Formula | C17H18O3 |
|---|
| Molecular Weight | 270.323 |
|---|
| Flash Point | 159.7±20.3 °C |
|---|
| Exact Mass | 270.125580 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 5.16 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.564 |
|---|
| InChIKey | CMNSCPHEWQDYHW-UHFFFAOYSA-N |
|---|
| SMILES | CCCCOc1ccc(-c2ccc(C(=O)O)cc2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2922299090 |
|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 4-N-Butyloxybiphenyl-4-N'-carboxylicacid |
| 4-<4'-(butyloxy)phenyl>benzoic acid |
| 4-N-Butyloxybiphenyl-4'-carboxylic acid |
| 4'-butoxy-biphenyl-4-carboxylic acid |
| 4'-Butoxybiphenyl-4-carboxylic acid |
| 4'-Butoxy-biphenyl-4-carbonsaeure |
| [1,1'-Biphenyl]-4-carboxylic acid, 4'-butoxy- |
| 4-BUTOXY-4'-BIPHENYLCARBOXYLIC ACID |
| 4'-Butoxy-4-biphenylcarboxylic acid |
| 1-(butyloxy)-4'-carboxybiphenyl |
| 4-(4-n-butyloxyphenyl)-benzoic acid |
| 4-(4-n-Butyloxyphenyl)benzoesaeure |