Introduction：Basic information about CAS 40630-71-5|2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxycarbonyl]benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxycarbonyl]benzoic acid |
|---|
| CAS Number | 40630-71-5 | Molecular Weight | 280.27300 |
|---|
| Density | 1.245g/cm3 | Boiling Point | 427.239ºC at 760 mmHg |
|---|
| Molecular Formula | C14H16O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 159.031ºC |
|---|
Names
| Name | 2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxycarbonyl]benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.245g/cm3 |
|---|
| Boiling Point | 427.239ºC at 760 mmHg |
|---|
| Molecular Formula | C14H16O6 |
|---|
| Molecular Weight | 280.27300 |
|---|
| Flash Point | 159.031ºC |
|---|
| Exact Mass | 280.09500 |
|---|
| PSA | 82.06000 |
|---|
| LogP | 1.69310 |
|---|
| Index of Refraction | 1.528 |
|---|
| InChIKey | PCLHPOXWGFYRRM-UHFFFAOYSA-N |
|---|
| SMILES | CC1(C)OCC(COC(=O)c2ccccc2C(=O)O)O1 |
|---|
Synonyms
| 2,3-Dimethylmethylendioxy)propyl-monophthalat |
| isopropylidene glycerol 2-carboxybenzoate |
| isopropylideneglycerol hydrogen phthalate |
| 2-(((2,2-dimethyl-1,3-dioxolan-4-yl)methoxy)carbonyl)benzoic acid |
