Introduction：Basic information about CAS 214476-08-1|3-Cyano-7-ethoxy-4-hydroxy-6-nitroquinoline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Cyano-7-ethoxy-4-hydroxy-6-nitroquinoline |
|---|
| CAS Number | 214476-08-1 | Molecular Weight | 259.21800 |
|---|
| Density | 1.452g/cm3 | Boiling Point | 456.346ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9N3O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 229.79ºC |
|---|
Names
| Name | 7-ethoxy-6-nitro-4-oxo-1H-quinoline-3-carbonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.452g/cm3 |
|---|
| Boiling Point | 456.346ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9N3O4 |
|---|
| Molecular Weight | 259.21800 |
|---|
| Flash Point | 229.79ºC |
|---|
| Exact Mass | 259.05900 |
|---|
| PSA | 111.70000 |
|---|
| LogP | 2.22988 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.631 |
|---|
| InChIKey | YWXULSPHZDNVAN-UHFFFAOYSA-N |
|---|
| SMILES | CCOc1cc2[nH]cc(C#N)c(=O)c2cc1[N+](=O)[O-] |
|---|
Synonyms
| 3-Cyano-7-ethoxy-4-hydroxy-6-nitroquinoline |
| ZLE0131 |
| 7-Ethoxy-4-hydroxy-6-nitro-quinoline-3-carbonitrile |
| 7-Ethoxy-4-hydroxy-6-nitro-3-quinolinecarbonitrile |
