Introduction:Basic information about CAS 67589-41-7|4β-Propyl-1α-cyclohexanecarboxylic acid 4-butoxyphenyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4β-Propyl-1α-cyclohexanecarboxylic acid 4-butoxyphenyl ester |
|---|
| CAS Number | 67589-41-7 | Molecular Weight | 318.45000 |
|---|
| Density | 1.003g/cm3 | Boiling Point | 423.4ºC at 760 mmHg |
|---|
| Molecular Formula | C20H30O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 180.2ºC |
|---|
Names
| Name | (4-butoxyphenyl) 4-propylcyclohexane-1-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.003g/cm3 |
|---|
| Boiling Point | 423.4ºC at 760 mmHg |
|---|
| Molecular Formula | C20H30O3 |
|---|
| Molecular Weight | 318.45000 |
|---|
| Flash Point | 180.2ºC |
|---|
| Exact Mass | 318.21900 |
|---|
| PSA | 35.53000 |
|---|
| LogP | 5.37740 |
|---|
| Index of Refraction | 1.498 |
|---|
| InChIKey | OBOYCOSBIKGKKI-UHFFFAOYSA-N |
|---|
| SMILES | CCCCOc1ccc(OC(=O)C2CCC(CCC)CC2)cc1 |
|---|
Synonyms
| Cyclohexanecarboxylic acid,4-propyl-,4-butoxyphenyl ester |
| 4-Butoxyphenyl 4-propylcyclohexanecarboxylate |
| Cyclohexanecarboxylic acid,4-propyl-,4-butoxyphenyl ester,trans |