Introduction：Basic information about CAS 908846-88-8|N-Fmoc-5-fluoro-L-tryptophan, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-Fmoc-5-fluoro-L-tryptophan |
|---|
| CAS Number | 908846-88-8 | Molecular Weight | 444.454 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 713.9±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C26H21FN2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 385.6±32.9 °C |
|---|
Names
| Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-fluoro-1H-indol-3-yl)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 713.9±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C26H21FN2O4 |
|---|
| Molecular Weight | 444.454 |
|---|
| Flash Point | 385.6±32.9 °C |
|---|
| Exact Mass | 444.148529 |
|---|
| PSA | 94.91000 |
|---|
| LogP | 5.47 |
|---|
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.678 |
|---|
| InChIKey | GIFXTRKMFUWKHR-DEOSSOPVSA-N |
|---|
| SMILES | O=C(NC(Cc1c[nH]c2ccc(F)cc12)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
|---|
| Storage condition | 2-8°C |
|---|
Synonyms
| Fmoc-5-fluoro-L-tryptophan |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-5-fluoro-L-tryptophan |
| SC1112 |
| L-Tryptophan, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-5-fluoro- |
| N-Fmoc-5-fluoro-L-tryptophan |
| Fmoc-Trp(5-F)-OH |
