Introduction：Basic information about CAS 123158-76-9|3-Chloro-5-iodo nitrobenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Chloro-5-iodo nitrobenzene |
|---|
| CAS Number | 123158-76-9 | Molecular Weight | 283.451 |
|---|
| Density | 2.1±0.1 g/cm3 | Boiling Point | 301.0±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H3ClINO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 135.8±22.3 °C |
|---|
Names
| Name | 1-Chloro-3-iodo-5-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.1±0.1 g/cm3 |
|---|
| Boiling Point | 301.0±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H3ClINO2 |
|---|
| Molecular Weight | 283.451 |
|---|
| Flash Point | 135.8±22.3 °C |
|---|
| Exact Mass | 282.889679 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 3.17 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.671 |
|---|
| InChIKey | MHCNYROPQXSCSQ-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1cc(Cl)cc(I)c1 |
|---|
Synonyms
| 1-Chloro-3-iodo-5-nitrobenzene |
| 1-chloro-3-iodo-5-nitro-benzene |
| 1-Chlor-3-jod-5-nitro-benzol |
| Benzene, 1-chloro-3-iodo-5-nitro- |
| 5-chloro-3-iodonitrobenzene |
| 3-chloro-5-iodonitrobenzene |
| 3-Chloro-5-iodo nitrobenzene |
