Introduction：Basic information about CAS 80151-24-2|3-(2-Nitrophenyl)-2-propyn-1-ol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(2-Nitrophenyl)-2-propyn-1-ol |
|---|
| CAS Number | 80151-24-2 | Molecular Weight | 177.157 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 340.8±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H7NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 152.8±12.2 °C |
|---|
Names
| Name | 3-(2-nitrophenyl)prop-2-yn-1-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 340.8±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H7NO3 |
|---|
| Molecular Weight | 177.157 |
|---|
| Flash Point | 152.8±12.2 °C |
|---|
| Exact Mass | 177.042587 |
|---|
| PSA | 66.05000 |
|---|
| LogP | 2.05 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.616 |
|---|
| InChIKey | OIRSFUOXMBOZKG-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccccc1C#CCO |
|---|
Safety Information
Synonyms
| 3-(2-nitro-phenyl)-prop-2-yn-1-ol |
| 3-(o-Nitrophenyl)propargyl alcohol |
| 3-(2-Nitrophenyl)-2-propyn-1-ol |
| 2-nitrophenylpropargyl alcohol |
| 2-Propyn-1-ol,3-(2-nitrophenyl) |
| 3-(2-Nitrophenyl)propargyl alcohol |
| 2-Propyn-1-ol, 3-(2-nitrophenyl)- |
| OR7578 |
