Introduction:Basic information about CAS 350511-08-9|2-[(2-bromo-1,3-thiazol-5-yl)sulfanylmethyl]-5-tert-butyl-1,3-oxazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[(2-bromo-1,3-thiazol-5-yl)sulfanylmethyl]-5-tert-butyl-1,3-oxazole |
|---|
| CAS Number | 350511-08-9 | Molecular Weight | 333.26800 |
|---|
| Density | 1.53g/cm3 | Boiling Point | 391.4ºC at 760 mmHg |
|---|
| Molecular Formula | C11H13BrN2OS2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 190.5ºC |
|---|
Names
| Name | 2-[(2-bromo-1,3-thiazol-5-yl)sulfanylmethyl]-5-tert-butyl-1,3-oxazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.53g/cm3 |
|---|
| Boiling Point | 391.4ºC at 760 mmHg |
|---|
| Molecular Formula | C11H13BrN2OS2 |
|---|
| Molecular Weight | 333.26800 |
|---|
| Flash Point | 190.5ºC |
|---|
| Exact Mass | 331.96500 |
|---|
| PSA | 92.46000 |
|---|
| LogP | 4.48340 |
|---|
| Index of Refraction | 1.622 |
|---|
| InChIKey | PWNRQULKRBVIPO-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1cnc(CSc2cnc(Br)s2)o1 |
|---|
Synonyms
| 2-((2-Bromothiazol-5-ylthio)-methyl)-5-tert-butyloxazole |
| QC-8285 |
| AC-7889 |