Introduction：Basic information about CAS 129245-21-2|(5-Aminopentyl)(phenylmethoxy)carbamic acid 1,1-dimethylethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (5-Aminopentyl)(phenylmethoxy)carbamic acid 1,1-dimethylethyl ester |
|---|
| CAS Number | 129245-21-2 | Molecular Weight | 308.41600 |
|---|
| Density | 1.057 | Boiling Point | 423.605ºC at 760 mmHg |
|---|
| Molecular Formula | C17H28N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 209.989ºC |
|---|
Names
| Name | tert-butyl N-(5-aminopentyl)-N-phenylmethoxycarbamate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.057 |
|---|
| Boiling Point | 423.605ºC at 760 mmHg |
|---|
| Molecular Formula | C17H28N2O3 |
|---|
| Molecular Weight | 308.41600 |
|---|
| Flash Point | 209.989ºC |
|---|
| Exact Mass | 308.21000 |
|---|
| PSA | 64.79000 |
|---|
| LogP | 4.18460 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.517 |
|---|
| InChIKey | DHJOLNKVLZRNGD-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N(CCCCCN)OCc1ccccc1 |
|---|
Synonyms
| N-(Benzyloxy)-N-(tert-butoxycarbonyl)-1,5-pentanediamine |
| AC-6934 |
| (5-Aminopentyl)(phenylmethoxy)carbamic acid tert-butyl ester |
| N-(5-aminopentyl)-N-(tert-butoxycarbonyl)-O-benzylhydroxylamine |
| HMS3098M06 |
| tert-butyl 5-aminopentyl(benzyloxy)carbamate |
| O-benzyl-N-(5-aminopentyl)-N-(tert-butoxycarbonyl)hydroxylamine |
