Introduction：Basic information about CAS 80020-41-3|furyloxyfen, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | furyloxyfen |
|---|
| CAS Number | 80020-41-3 | Molecular Weight | 403.73700 |
|---|
| Density | 1.456g/cm3 | Boiling Point | 451.5ºC at 760 mmHg |
|---|
| Molecular Formula | C17H13ClF3NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 226.9ºC |
|---|
Names
| Name | furyloxyfen |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.456g/cm3 |
|---|
| Boiling Point | 451.5ºC at 760 mmHg |
|---|
| Molecular Formula | C17H13ClF3NO5 |
|---|
| Molecular Weight | 403.73700 |
|---|
| Flash Point | 226.9ºC |
|---|
| Exact Mass | 403.04300 |
|---|
| PSA | 73.51000 |
|---|
| LogP | 5.75020 |
|---|
| Index of Refraction | 1.556 |
|---|
| InChIKey | WYJOEQHHWHAJRB-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(Oc2ccc(C(F)(F)F)cc2Cl)cc1OC1CCOC1 |
|---|
Synonyms
| AC-466 |
| Furan,3-(5-(2-chloro-4-(trifluoromethyl)phenoxy)-2-nitrophenoxy)tetrahydro |
| (RS)-5-(2-chloro-α,α,α-trifluoro-p-tolyloxy)-2-nitrophenyl tetrahydro-3-furyl ether |
| rac-(3R)-3-{5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy}oxolane |
| Furyloxyfen [ISO] |
| 3-{5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy}tetrahydrofuran |
| 3-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]tetrahydrofuran |
| 3-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]oxolane |
| Furyloxyfen |
