Introduction：Basic information about CAS 146063-25-4|4-[2-(2-Oxiranyl)ethoxy]benzoic acid 4-[2-(2-oxiranyl)ethoxy]phenyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[2-(2-Oxiranyl)ethoxy]benzoic acid 4-[2-(2-oxiranyl)ethoxy]phenyl ester |
|---|
| CAS Number | 146063-25-4 | Molecular Weight | 370.39600 |
|---|
| Density | 1.257 | Boiling Point | 548.2ºC at 760 mmHg |
|---|
| Molecular Formula | C21H22O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 240.7ºC |
|---|
Names
| Name | [4-[2-(oxiran-2-yl)ethoxy]phenyl] 4-[2-(oxiran-2-yl)ethoxy]benzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.257 |
|---|
| Boiling Point | 548.2ºC at 760 mmHg |
|---|
| Molecular Formula | C21H22O6 |
|---|
| Molecular Weight | 370.39600 |
|---|
| Flash Point | 240.7ºC |
|---|
| Exact Mass | 370.14200 |
|---|
| PSA | 69.82000 |
|---|
| LogP | 3.24120 |
|---|
| Vapour Pressure | 4.55E-12mmHg at 25°C |
|---|
| Index of Refraction | 1.581 |
|---|
| InChIKey | PEUDQALZZZOUAG-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Oc1ccc(OCCC2CO2)cc1)c1ccc(OCCC2CO2)cc1 |
|---|
Synonyms
| 4-[2-(oxiran-2-yl)ethoxy]phenyl 4-[2-(oxiran-2-yl)ethoxy]benzoate |
