Introduction：Basic information about CAS 19224-29-4|2-[4-[2-[4-(2-acetyloxyethoxy)phenyl]propan-2-yl]phenoxy]ethyl acetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[4-[2-[4-(2-acetyloxyethoxy)phenyl]propan-2-yl]phenoxy]ethyl acetate |
|---|
| CAS Number | 19224-29-4 | Molecular Weight | 400.46500 |
|---|
| Density | 1.122g/cm3 | Boiling Point | 496.7ºC at 760mmHg |
|---|
| Molecular Formula | C23H28O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 213.1ºC |
|---|
Names
| Name | 2-[4-[2-[4-(2-acetyloxyethoxy)phenyl]propan-2-yl]phenoxy]ethyl acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.122g/cm3 |
|---|
| Boiling Point | 496.7ºC at 760mmHg |
|---|
| Molecular Formula | C23H28O6 |
|---|
| Molecular Weight | 400.46500 |
|---|
| Flash Point | 213.1ºC |
|---|
| Exact Mass | 400.18900 |
|---|
| PSA | 71.06000 |
|---|
| LogP | 3.89630 |
|---|
| Vapour Pressure | 5.29E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.523 |
|---|
| InChIKey | HBDPNIKSHRQAJF-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)OCCOc1ccc(C(C)(C)c2ccc(OCCOC(C)=O)cc2)cc1 |
|---|
Synonyms
| dianol 22 diacetate |
| Ethanol,2,2'-((1-methylethylidene)bis(4,1-phenyleneoxy))bis-,diacetate |
| propane-2,2-diylbis(benzene-4,1-diyloxyethane-2,1-diyl) diacetate |
| 2,2'-[(1-methylethylidene)bis(4,1-phenyleneoxy)]bisethyl diacetate |
| EINECS 242-895-2 |
| dyanol 22 diacetate |
