Introduction：Basic information about CAS 190071-23-9|methyl 4-acetamido-3-iodobenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | methyl 4-acetamido-3-iodobenzoate |
|---|
| CAS Number | 190071-23-9 | Molecular Weight | 319.09600 |
|---|
| Density | 1.748g/cm3 | Boiling Point | 444.4ºC at 760 mmHg |
|---|
| Molecular Formula | C10H10INO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 222.6ºC |
|---|
Names
| Name | methyl 4-acetamido-3-iodobenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.748g/cm3 |
|---|
| Boiling Point | 444.4ºC at 760 mmHg |
|---|
| Molecular Formula | C10H10INO3 |
|---|
| Molecular Weight | 319.09600 |
|---|
| Flash Point | 222.6ºC |
|---|
| Exact Mass | 318.97100 |
|---|
| PSA | 58.89000 |
|---|
| LogP | 2.68570 |
|---|
| Vapour Pressure | 4.29E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.633 |
|---|
| InChIKey | XWTQNEZTXKVCML-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1ccc(NC(C)=O)c(I)c1 |
|---|
Synonyms
| methyl 4-acetamido-3-iodanyl-benzoate |
| 4-acetylamino-3-iodo-benzoic acid methyl ester |
| 3-acetamido-4-iodobenzoic methyl ester |
| AR3230 |
| methyl 4-acetylamino-3-iodobenzoate |
