Introduction:Basic information about CAS 53-57-6|ent-NADPH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ent-NADPH |
|---|
| CAS Number | 53-57-6 | Molecular Weight | 745.421 |
|---|
| Density | 2.3±0.1 g/cm3 | Boiling Point | 1175.1±75.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H30N7O17P3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 664.5±37.1 °C |
|---|
Names
| Name | nadph |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.3±0.1 g/cm3 |
|---|
| Boiling Point | 1175.1±75.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H30N7O17P3 |
|---|
| Molecular Weight | 745.421 |
|---|
| Flash Point | 664.5±37.1 °C |
|---|
| Exact Mass | 745.091125 |
|---|
| PSA | 394.57000 |
|---|
| LogP | -5.93 |
|---|
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.849 |
|---|
| InChIKey | ACFIXJIJDZMPPO-NNYOXOHSSA-N |
|---|
| SMILES | NC(=O)C1=CN(C2OC(COP(=O)(O)OP(=O)(O)OCC3OC(n4cnc5c(N)ncnc54)C(OP(=O)(O)O)C3O)C(O)C2O)C=CC1 |
|---|
| Storage condition | 2-8°C |
|---|
Synonyms
| ent-NADPH |
| [[(2S,3S,4S,5S)-5-(6-aminopurin-9-yl)-3-hydroxy-4-phosphonooxy-te trahydrofuran-2-yl]methoxy-hydroxy-phosphoryl] [(2S,3R,4S,5S)-5-( 3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxy-tetrahydrofuran-2-yl]m ethyl hydrogen phosphate |
| Di-t-butyl iminodicarboxylate |
| tert-Butyl iminodicarboxylate |
| N-Boc-tert-butylcarbamate |
| di-tert-butyl imidodicarbonate |
| Iminodicarboxylic Acid Di-tert-butyl Ester |
| Di-tert-butyl-iminodicarboxylate |
| di-tert-butyl iminodicarbonate |