Introduction：Basic information about CAS 389-36-6|D-(tetrahydro-2,3,4-trihydroxy-5-oxofuran-2-yl)glycollic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | D-(tetrahydro-2,3,4-trihydroxy-5-oxofuran-2-yl)glycollic acid |
|---|
| CAS Number | 389-36-6 | Molecular Weight | 210.13900 |
|---|
| Density | / | Boiling Point | 630.3ºC at 760mmHg |
|---|
| Molecular Formula | C6H10O8 | Melting Point | 91-93ºC(lit.) |
|---|
| MSDS | / | Flash Point | 335ºC |
|---|
Names
| Name | (2S)-[(2S,3R,4R)-3,4-Dihydroxy-5-oxotetrahydro-2-furanyl](hydroxy )acetic acid hydrate (1:1) (non-preferred name) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 630.3ºC at 760mmHg |
|---|
| Melting Point | 91-93ºC(lit.) |
|---|
| Molecular Formula | C6H10O8 |
|---|
| Molecular Weight | 210.13900 |
|---|
| Flash Point | 335ºC |
|---|
| Exact Mass | 210.03800 |
|---|
| PSA | 133.52000 |
|---|
| InChIKey | XECPAIJNBXCOBO-MMPJQOAZSA-N |
|---|
| SMILES | O=C1OC(C(O)C(=O)O)C(O)C1O |
|---|
Safety Information
| WGK Germany | 3 |
|---|
| HS Code | 2932190090 |
|---|
Customs
| HS Code | 2932190090 |
|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| saccharic acid 1,4-lactone |
| D-saccaric acid 1,4-lactone |
| D-Glucaro-6,3-lactone |
| D-Saccharolactone |
| EINECS 206-865-2 |
| D-Glucarsaeure-6->3-lacton |
| glucaric acid |
| ketogluconic acid |
| D-glucaric acid |
| D-glucaro-1,4-lactone monohydrate |
| MFCD00149334 |
| D-saccharic acid-1,4-lactone |
| D-Glucosaccharo-3,6-lacton |
| D-saccharic acid |
| D-Glucarsaeure-3,6-lacton |
| D-glucaric acid-6=>3-lactone |
| saccharic acid |
| D-Glucosaccharo-6,3-lacton |
